Phương pháp giải bài tập các phản ứng hóa học của este (hay, chi tiết)

Bài viết Phương pháp giải bài tập các phản ứng hóa học của este với phương pháp giải chi tiết giúp học sinh ôn tập, biết cách làm bài tập Phương pháp giải bài tập các phản ứng hóa học của este.

Phương pháp giải bài tập các phản ứng hóa học của este (hay, chi tiết)

Bài giảng: Tổng hợp bài tập Este - Lipit - Cô Nguyễn Thị Thu (Giáo viên VietJack)

Lý thuyết

1. Phản ứng của nhóm chức este

- Thủy phân este trong môi trường axit là phản ứng nghịch với phản ứng este hóa :

R–COO–R’ + H–OH Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12 R–COOH + R’–OH

- Phản ứng thủy phân trong môi trường kiềm là phản ứng một chiều và còn được gọi là phản ứng xà phòng hóa :

R–COO–R’ + NaOH Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12 R–COONa + R’–OH

Chú ý: Nếu este dạng lipit (chất béo) khi xà phòng hóa, ta thu được glixerol C3H5(OH)3 và xà phòng.

(RCOO)3C3H5 + 3NaOH Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12 C3H5(OH)3 + 3RCOONa

2. Phản ứng khử este

Este bị khử bởi liti nhôm hiđrua (LiAlH4), khi đó nhóm RCO– (gọi là nhóm axyl) trở thành ancol bậc I :

R–COO–R’ Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12 R–CH2–OH + R’–OH

3. Phản ứng ở gốc hiđrocacbon

Este có thể tham gia phản ứng thế, cộng, tách, trùng hợp,…Sau đây chỉ xét phản ứng cộng và phản ứng trùng hợp.

- Phản ứng cộng vào gốc không no: Gốc hiđrocacbon không no ở este có phản ứng cộng với H2, Br2, Cl2, … giống hiđrocacbon không no.

Ví dụ :

CH3[CH2]7CH=CH[CH2]7COOCH3 + H2 Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12 CH3[CH2]16COOCH3

CH3[CH2]7CH=CH[CH2]7COOCH3: metyl oleat

CH3[CH2]16COOCH3: metyl stearat

- Phản ứng trùng hợp : Một số este đơn giản có liên kết C = C tham gia phản ứng trùng hợp giống như anken.

- Este của axit fomic HCOOR’ có các tính chất của andehit: phản ứng tráng gương, phản ứng tạo kết tủa đỏ gạch với Cu(OH)2

4. Phản ứng đốt cháy este

RCOOR’ + O2 Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12 CO2 + H2O

Nếu Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12 thì este là no, đơn chức ⇒ CTTQ là: CnH2nO2

5. Phản ứng este hóa (Phản ứng điều chế este)

RCOOH + R’OH Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12 R–COO–R’ + H2O

Ví dụ:

CH3COOH + C2H5OH Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12 CH3COOC2H5 +H2O

Đặc biệt: Điều chế este của phenol phải dùng anhidrit axit hoặc clorua axit

C6H5OH + (CH3CO)2O → CH3COOC6H5 + CH3COOH

Ví dụ minh họa

Ví dụ 1: Cho sơ đồ sau: CH2=CH2 Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12 X → Y Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12 Z

Vậy chất Z là?

Lời giải

CH2=CH2 + H2O Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12 CH3CH2OH (X)

CH3CH2OH + O2 Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12 CH3COOH (Y) + H2O

CH3COOH + CH3CH2OH Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12 CH3COOC2H5 (Z) + H2O

Ví dụ 2: Metyl acrylat được điều chế từ axit và rượu nào ?

A. CH2=C(CH3)COOH và C2H5OH.

B. CH2=CHCOOH và C2H5OH.

C. CH2=C(CH3)COOH và CH3OH.

D. CH2=CHCOOH và CH3OH.

Giải

Đáp án D

Metyl acrylat: CH2=CHCOOCH3

CH2=CHCOOH + CH3OH → CH2=CHCOOCH3 + H2O

Ví dụ 3: Thủy phân este C4H6O2 (xúc tác axit) được hai chất hữu cơ X, Y. Từ X có thể điều chế trực tiếp ra Y. Vậy X là :

A. anđehit axetic.    B. ancol etylic.

C. axit axetic.    D. axit fomic.

Giải

Đáp án A

CH3COOCH=CH2 + H2O Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12 CH3COOH + CH3CHO

Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12

Bài tập vận dụng

Câu 1. Cho sơ đồ điều chế chất E từ metan như sau:

Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12

Vậy chất E là:

A. C2H5OH

B. CH3COOH

C. HCOOCH3

D. CH3CHO

Lời giải:

Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12

Câu 2. Propyl fomat được điều chế từ

A. axit fomic và ancol metylic.

B. axit fomic và ancol propylic.

C. axit axetic và ancol propylic.

D. axit propionic và ancol metylic.

Lời giải:

Đáp án B

Propyl fomat: HCOOC3H7

HCOOH + C3H7OH → HCOOC3H7 + H2O

Câu 3. Cho phản ứng: CH3CH2COOCH=CH2 + H2O Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12

Sản phẩm thu được từ phản ứng trên gồm:

A. CH3CH2COOCH + CH2=CHOH

B. CH2=CHCOOH + CH3CH2OH

C. CH3CH2COOCH + CH3CHO

D. CH3CH2OH + CH3CHO

Lời giải:

CH3CH2COOCH=CH2 + H2O Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12 CH3CH2COOH + CH2=CH-OH

Vì CH2=CH-OH kém bền nên sẽ biến thành CH3CHO

Câu 4. Cho sơ đồ chuyển hoá sau:

1) C3H4O2 + NaOH → (A) + (B)

2) (A) + H2SO4 loãng → (C) + (D)

3) (C) + AgNO3 + NH3 + H2O → (E) + Ag↓ + NH4NO3

4) (B) + AgNO3 + NH3 + H2O → (F) + Ag↓ + NH4NO3

Các chất B và A có thể là:

A. CH3CHO và HCOONa

B. HCOOH và CH3CHO

C. HCHO và HCOOH

D. HCHO và CH3CHO

Lời giải:

Đáp án A

(1) HCOOCH=CH2 + NaOH → HCOONa + CH3CHO

(2) HCOONa + H2SO4 → HCOOH + Na2SO4

(3) HCOOH + AgNO3 + NH3 + H2O → (NH4)2CO3 + Ag + NH4NO3

(4) CH3CHO + AgNO3 + NH3 + H2O → CH3COONH4 + Ag + NH4NO3

Câu 5. Thủy phân este E có công thức phân tử C4H8O2 với xúc tác axit vô cơ loãng, thu được hai sản phẩm hữu cơ X, Y (chỉ chứa các nguyên tử C, H, O). Từ X có thể điều chế trực tiếp ra Y bằng một phản ứng duy nhất. Chất X là:

A. Axit axetic

B. Rượu etylic

C. Etyl axetat

D. Axit fomic

Lời giải:

Đáp án B

Ta thấy: CH3COOC2H5 + H2O Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12 CH3COOH + C2H5OH

C2H5OH + O2 Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12 CH3COOH + H2O

Vậy X là C2H5OH

Câu 6. Cho dãy chuyển hóa sau:

Phenol Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12 Phenyl axetat Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12 Y (hợp chất thơm)

Hai chất X, Y trong sơ đồ trên lần lượt là:

A. anhidrit axetic, phenol

B. anhidrit axetic, natri phenolnat

C. axit axetic, natri phenolnat

D. axit axetic, phenol

Lời giải:

Giải

Đáp án B

Các PTHH xảy ra:

Phương pháp giải bài tập các phản ứng hóa học của este hay, chi tiết | Hóa học lớp 12

Vậy X là anhidrit axetic: (CH3CO)2O, Y là natri phenolnat: C6H5ONa

Bài giảng: Bài toán thủy phân Este, chất béo - Cô Nguyễn Thị Thu (Giáo viên VietJack)

Xem thêm các dạng bài tập Hóa học lớp 12 có trong đề thi THPT Quốc gia khác:

Săn shopee giá ưu đãi :

ĐỀ THI, GIÁO ÁN, GÓI THI ONLINE DÀNH CHO GIÁO VIÊN VÀ PHỤ HUYNH LỚP 12

Bộ giáo án, đề thi, bài giảng powerpoint, khóa học dành cho các thầy cô và học sinh lớp 12, đẩy đủ các bộ sách cánh diều, kết nối tri thức, chân trời sáng tạo tại https://tailieugiaovien.com.vn/ . Hỗ trợ zalo VietJack Official

este-lipit.jsp

Giải bài tập lớp 12 sách mới các môn học
Tài liệu giáo viên