Đề thi Hóa học 12 Giữa kì 1 năm 2021 - 2022 có đáp án (4 đề)

Dưới đây là danh sách Đề thi Hóa học 12 Giữa kì 1 năm 2021 - 2022 có đáp án (4 đề). Bạn vào tên đề để xem đề kiểm tra Hóa học lớp 12 tương ứng.

4 đề kiểm tra giữa kì 1 sưu tầm

Quảng cáo

Phòng Giáo dục và Đào tạo .....

Đề thi Giữa học kì 1

Môn: Hóa Học 12

Thời gian làm bài: 45 phút

(Đề 1)

Câu 1: Benzyl axetat là một este có mùi thơm của hoa nhài. Công thức của benzyl axetat là:

A. C6H5 – COO – CH3.

B. CH3– COO– CH2–C6H5.

C. CH3– COO– C6H5.

D. C6H5– CH2– COO– CH3.

Câu 2: Cho dãy biến hoá: X là

X Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1) Y Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1) Z → K → cao su buna

A. Tinh bột.

B. Etylen.

C. Etyl clorua.

D. Butan.

Câu 3: Este nào sau đây thủy phân cho hỗn hợp 2 chất hữu cơ đều tham gia phản ứng tráng bạc?

A. CH3COOC2H5.

B. CH3COOCH=CH2.

C. HCOOCH2CH=CH2.

D. HCOOCH=CH– CH3.

Câu 4: Cho 360 gam glucozơ lên men tạo thành ancol etylic, khí sinh ra được dẫn vào dung dịch nước vôi trong dư thu được m gam kết tủa. Biết hiệu suất của quá trình lên men đạt 80 %. Vậy giá trị của m là

A. 200 gam.     B. 320 gam.

C. 400 gam.     D. 160 gam.

Câu 5: Hợp chất X có CTPT C4H6O2. Khi thủy phân X thu được 1 axit Y và 1 anđehit Z. Oxi hóa Z thu được Y. Trùng hợp X cho ra 1 polime. CTCT của X là

A. HCOOC3H5.

B. C2H3COOCH3.

C. CH3COOC2H3.

D. C3H5COOH.

Câu 6: Tại một nhà máy rượu, cứ 10 tấn tinh bột sẽ sản xuất được 1,5 tấn rượu etylic. Hiệu suất cả quá trình điều chế là

A. 26,4%     B. 15%

C. 85%     D. 32,7%

Câu 7: Lần lượt cho các chất: phenol, axit acrylic, axit fomic, metyl axetat phản ứng với Na, dung dịch NaOH đun nóng. Số trường hợp có phản ứng xảy ra là

A. 5.     B. 6.

C. 7.     D. 8.

Câu 8: Có 3 chất saccarozơ, mantozơ, anđehit axetic. Dùng thuốc thử nào để phân biệt?

A. AgNO3/NH3

B. Cu(OH)2/NaOH.

C. Dung dịch Br2

D. Na.

Câu 9: Este X có CTPT C4H8O2. Tên gọi của X là

Biết: X Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1) Y1 + Y2 ; Y1 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1) Y2

A. isopropyl fomat.

B. etyl axetat.

C. metyl propionat.

D. n– propyl fomat.

Câu 10: Phản ứng nào sau đây không tạo ra glucozơ?

A. Lục hợp HCHO xúc tác Ca(OH)2.

B. Tam hợp CH3CHO.

C. Thủy phân mantozơ.

D. Thủy phân saccarozơ.

Câu 11: Chất hữu cơ X có CTPT là C4H6O2Cl2. Khi cho X phản ứng với dung dịch NaOH thu được HO– CH2– COONa, etylenglicol và NaCl. CTCT của X là

A. CH2Cl– COO– CHCl– CH3.

B. CH3– COO– CHCl– CH2Cl.

C. CHCl2– COO– CH2CH3.

D. CH2Cl– COO– CH2– CH2Cl.

Câu 12: Cho 360 gam glucozơ lên men thành ancol etylic (giả sử chỉ có phản ứng tạo thành ancol etylic). Cho tất cả khí CO2 hấp thụ vào dung dịch NaOH thì thu được 212 gam Na2CO3 và 84 gam NaHCO3. Hiệu suất của phản ứng lên men rượu là

A. 50%     B. 62,5%

C. 75%     D. 80%

Câu 13: Tổng số hợp chất hữu cơ no, đơn chức, mạch hở, có cùng công thức phân tử C5H10O2, phản ứng được với dung dịch NaOH nhưng không có phản ứng tráng bạc là

A. 4     B. 5.

C. 8.     D. 9.

Câu 14: Phát biểu không đúng là

A. Dung dịch fructozơ hoà tan được Cu(OH)2.

B. Thủy phân (xúc tác H+, to) saccarozơ cũng như mantozơ đều cho cùng một monosaccarit

C. Sản phẩm thủy phân xenlulozơ (xúc tác H+, to) có thể tham gia phản ứng tráng gương

D. Dung dịch mantozơ tác dụng với Cu(OH)2 khi đun nóng cho kết tủa Cu2O.

Câu 15: Cho các phản ứng:

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1)

Công thức phân tử của X là

A. C12H20O6.

B. C12H14O4

C. C11H10O4.

D. C11H12O4.

Câu 16: Khối lượng phân tử trung bình của xenlulozơ trong sợi bông là 4860000 đvC. Vậy số gốc glucozơ có trong xenlulozơ nêu trên là

A. 28000.     B. 30000.

C. 35000.     D. 25000.

Câu 17: Cho công thức chất X là C3H5Br3. Khi X tác dụng với dung dịch NaOH dư tạo ra một hợp chất tạp chức của ancol bậc I và anđehit. Công thức cấu tạo của X là

A. CH3– CHBr– CHBr2.

B. CH2Br– CH2– CHBr2.

C. CH2Br– CHBr– CH2Br.

D. CH3– CBr2– CH2Br.

Câu 18: Cho 3 chất: Glucozơ, axit axetic, glixerol. Để phân biệt 3 chất trên chỉ cần dùng 2 hoá chất là

A. Dung dịch Na2CO3 và Na

B. Quỳ tím và Ag2O/dd NH3.

C. Dung dịch NaHCO3 và dung dịch AgNO3

D. Quỳ tím và Na

Câu 19: Cho sơ đồ phản ứng sau:

Este X + NaOH → CH3COONa + Chất hữu cơ Y

Y + O2 -xt→ Y1

Y1 + NaOH → CH3COONa + H2O

Có tất cả bao nhiêu chất X thỏa mãn sơ đồ trên?

A. 1.     B. 4.

C. 2.     D. 3.

Câu 20: Để sản xuất 1 tấn thuốc nổ proxilin (xem như là trinitrat xenlulozơ nguyên chất) thì cần dùng một lượng xenlulozơ là

A. 1000kg     B. 611,3kg

C. 545,4kg     D. 450,5kg

Câu 21: Cho 10 gam chất X (chỉ chứa nhóm chức este có phân tử khối là 100 đvC) tác dụng với 150 ml dung dịch NaOH 1M. Sau phản ứng, cô cạn dung dịch thu được 11,6 gam chất rắn khan và một chất hữu cơ Y. Công thức của Y là

A. CH3OH.     B. C2H5OH.

C. CH3CHO.     D. CH3COCH3.

Câu 22: Phát biểu nào sau đây là sai?

A. Mantozơ là đồng phân của saccarozơ.

B. Hợp chất saccarozơ thuộc loại đisaccarit, phân tử này được cấu tạo bởi 2 gốc glucozơ.

C. Phân tử saccarozơ có nhiều nhóm hyđroxyl nhưng không có nhóm chức anđehit.

D. Xenlulozơ là hợp chất cao phân tử thiên nhiên, mạch không phân nhánh và do các mắt xích glucozơ tạo nên.

Câu 23: Cho 0,1 mol phenyl axetat tác dụng với 250ml dung dịch NaOH 1M thu được dung dịch X. Cô cạn X được m gam chất rắn. Giá trị của m là

A. 21,8.     B. 8,2.

C. 19,8.     D. 14,2.

Câu 24: Để phân biệt dung dịch mất nhãn gồm glucozơ, saccarozơ, CH3CHO, ancol etylic, hồ tinh bột ta dùng thuốc thử

A. I2, Cu(OH)2 to

B. I2, HNO3

C. I2, AgNO3/NH3

D. AgNO3/NH3, HNO3 to

Câu 25: Hỗn hợp M gồm hai chất hữu cơ X và Y. Cho M tác dụng vừa đủ với 150 ml dung dịch NaOH 1M đun nóng, thu được 14,1 gam một muối và 2,3 gam một ancol no, mạch hở. Nếu đốt cháy hoàn toàn lượng M trên thì thu được 0,55 mol CO2. Công thức của X và Y lần lượt là

A. CH2=CHCOOH và CH2=CH–COO– CH3.

B. CH≡C–COOH và CH≡C–COO–CH3.

C. CH≡C–COOH và CH≡C–COO–C2H5.

D. CH2=CHCOOH và CH2=CH–COO–C2H5.

Câu 26: Hiđro hoá hoàn toàn m gam hỗn hợp gồm glucozơ và fructozơ cần phải dùng 4,48lít khí H2 ở đktc. Mặt khác, cũng m gam hỗn hợp này tác dụng vừa hết với 8 gam Br2 trong dung dịch. Số mol của glucozơ và fructozơ trong m gam hỗn hợp này lần lượt là

A. 0,05 mol và 0,15 mol

B. 0,05 mol và 0,35 mol

C. 0,1 mol và 0,15 mol

D. 0,2 mol và 0,2 mol

Câu 27: Cho a gam chất hữu cơ X chứa C, H, O tác dụng với dung dịch NaOH vừa đủ, sau đó chưng khô thì phần bay hơi chỉ có 1,8 gam nước, phần chất rắn khan còn lại chứa hai muối của natri có khối lượng 11,8 gam. Nung hai muối này trong oxi dư, sau khi phản ứng hoàn toàn, ta thu được 7,95 gam Na2CO3; 7,28 lít khí CO2 (đktc) và 3,15 gam nước. Công thức đơn giản nhất của X là

A. C8H8O3.     B. C8H8O2.

C. C6H6O2.     D. C7H8O3.

Câu 28: Từ 180 gam glucozơ, bằng phương pháp lên men rượu, thu được a gam ancol etylic (hiệu suất 80%). Oxi hoá 0,1a gam ancol etylic bằng phương pháp lên men giấm, thu được hỗn hợp X. Để trung hoà hỗn hợp X cần 720 ml dung dịch NaOH 0,2M. Hiệu suất quá trình lên men giấm là

A. 10%     B. 90%

C. 80%     D. 20%

Câu 29: Hỗn hợp X gồm hai chất hữu cơ. X phản ứng với dung dịch KOH vừa đủ, cần dùng 100ml dung dịch KOH 5M. Sản phẩm phản ứng gồm 2 muối của một axit cacboxylic đơn chức và một ancol đơn chức. Cho toàn bộ lượng ancol tác dụng hết với Na thu được 3,36 lít H2 (đktc). X gồm

A. 1 axit và 1 ancol

B. 1 este và 1 axit

C. 2 este

D. 1 este và 1 ancol

Câu 30: Trong chế tạo ruột phích người ta thường dùng phương pháp nào sau đây:

A. Cho axetilen tác dụng với dung dịch AgNO3/NH3

B. Cho anđehit fomic tác dụng với dung dịch AgNO3/NH3

C. Cho axit fomic tác dụng với dung dịch AgNO3/NH3

D. Cho glucozơ tác dụng với dung dịch AgNO3/NH3.

Đáp án & Thang điểm

Câu 1: Đáp án B

Benzyl axetat có mùi thơm của hoa nhài.

CTCT: CH3– COO– CH2– C6H5.

* Thêm một số mùi este thông dụng khác:

isoamyl axetat: mùi chuối chín

etyl butirat và etyl propionat: mùi dứa.

geranyl axetat: mùi hoa hồng.

Câu 2: Đáp án A

X là tinh bột. Sơ đồ chuyển hóa như sau:

C6H10O5 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1) C6H12O6 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1) C2H5OH Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1) C4H6 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1) Cao su buna

Câu 3: Đáp án D

CH3COOC2H5 + NaOH → CH3COONa + C2H5OH

CH3COOCH=CH2 + NaOH → CH3COONa + CH3CHO

HCOOCH2CH=CH2 + NaOH → HCOONa + CH2=CHCH2OH

HCOOCH=CH– CH3 + NaOH → HCOONa + CH3– CH2CHO

→ Este thủy phân cho hỗn hợp hai chất hữu cơ đều tham gia phản ứng tráng bạc là HCOOCH=CH– CH3

Câu 4: Đáp án B

C6H12O6 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1) 2C2H5OH + 2CO2

CO2 + Ca(OH)2 dư → CaCO3 ↓ + H2O

Ta có: H = 80%

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1)

⇒ nCO2 = 1,6.2 = 3,2 mol = n

mCaCO3 = 3,2.100 = 320g.

Câu 5: Đáp án C

HCOOC3H5 + H2O Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1) HCOOH + C3H5OH

Oxi hóa C3H5OH không thu được HCOOH → không thỏa mãn.

• C2H3COOCH3 + H2O Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1) C2H3COOH + CH3OH

Oxi hóa CH3OH không thu được C2H3COOH → không thỏa mãn.

• CH3COOC2H3 + H2O Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1) CH3COOH + CH3CHO

2CH3CHO + O2 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1)

2CH3COOH

nCH3COOCH=CH2 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1) – (– CH(OCOCH3)– CH2– )n–

→ thỏa mãn.

• C3H5COOH không bị thủy phân → không thỏa mãn.

Câu 6: Đáp án A

Ta có: (C6H10O5)n Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1) 2nC2H5OH

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1)

Hiệu suất của phản ứng là:

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1)

Câu 7: Đáp án C

Có 3 chất phản ứng với Na là phenol, axit acrylic, axit fomic.

Có 4 chất phản ứng với dung dịch NaOH đun nóng là phenol, axit acrylic, axit fomic, metyl axetat.

⇒ Có 7 trường hợp có phản ứng xảy ra.

Câu 8: Đáp án B

Dùng Cu(OH)2/NaOH phân biệt saccarozơ, mantozơ, anđehit axetic.

Ở nhiệt độ thường saccarozơ, mantozơ hòa tan Cu(OH)2 tạo dung dịch phức đồng màu xanh lam, anđehit axetic không hiện tượng → nhận ra anđehit axetic.

Sau đó đun nóng hai ống nghiệm có phức xanh → xuất hiện chất kết tủa màu đỏ gạch Cu2O → mantozơ.

Câu 9: Đáp án B

X là etyl axetat.

CH3COOC2H5 + H2O ⇆ CH3COOH + C2H5OH

CH3CH2OH + O2 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1) CH3COOH + H2O

Câu 10: Đáp án B

Tam hợp CH3CHO được chất có CTPT: C6H12O3, không phải là glucozơ.

Câu 11: Đáp án D

CH2Cl– COO– CHCl– CH3 + 3NaOH → HO– CH2– COONa + CH3CHO + 2NaCl + H2O

CH3– COO– CHCl– CHCl + 3NaOH → CH3COONa + CH2OH– CHO + 2NaCl + H2O

CHCl2– COO– CH2– CH3 + 3NaOH → CHO– COONa + 2NaCl + CH3CH2OH

CH2Cl– COO– CH2– CH2Cl + 3NaOH → HO– CH2– COONa + CH2OH– CH2OH + 2NaCl

⇒ X là CH2Cl– COO– CH2– CH2Cl.

Câu 12: Đáp án C

Bảo toàn C có: nCO2(tt) = nNa2CO3 + nNaHCO3 = 2 + 1 = 3 mol.

C6H12O6 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1) 2C2H5OH + 2CO2

nGlucozo = 2 ⇒ nCO2 (lt) = 2.2 = 4 mol

H% = (3/4).100% = 75%

Câu 13: Đáp án D

C5H10O2 có k = 1 , phản ứng với dung dịch NaOH ⇒ este hoặc axit no, đơn chức, mạch hở.

Không có phản ứng tráng bạc ⇒ không phải là este của axir fomic

⇒ Có 9 hợp chất hữu cơ thỏa mãn là

1. CH3- CH2– CH2– CH2– COOH.

2. Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1)

3. Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1)

4. Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1)

5. CH3COOCH2CH2CH3

6. Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1)

7. CH3CH2COOCH2CH3

8. CH3CH2CH2COOCH3

9. (CH3)2CHCOOCH3

Câu 14: Đáp án B

Thủy phân (xúc tác H+, toC) saccarozơ cho 1 phân tử glucozơ và 1 phân tử fructozơ; mantozơ thủy phân tạo 2 phân tử glucozơ.

Câu 15: Đáp án C

Y + 2NaOH Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1) T + Na2CO3

⇒ Y là muối natri của axit hai chức.

CH3CHO + 2Cu(OH)2 + NaOH Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1) Z + ...

Z là CH3COONa

Z + NaOH Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1) CH4 + Na2CO3

Vậy Y là NaOCO– CH2– COONa.

X + 3NaOH Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1) C6H5ONa + NaOCO– CH2– COONa + CH3CHO + H2O

X có CTCT là C6H5OCO– CH2– COOCH=CH2 ⇒ X có CTPT là C11H10O4

Câu 16: Đáp án B

Số gốc glucozơ trong xenlulozơ = 4860000 / 162 = 30000.

Câu 17: Đáp án B

Muốn tạo ra anđehit cần có 2 nhóm Br đính vào C bậc I ⇒ loại C, D

Vì X khi X tạo ancol bậc I nên 1 nhóm Br còn lại đính với C bậc I ⇒ loại A

CH2Br– CH2– CHBr2 + 3NaOH → CH2(OH)– CH2– CHO + H2O + 3NaBr.

Câu 18: Đáp án B

Dùng quỳ tím phân biệt được axit axetic làm quỳ hóa đỏ

Dùng Ag2O/NH3: có kết tủa bạc là glucozơ

C sai vì AgNO3 thiếu môi trường NH3.

Câu 19: Đáp án C

Y1 là CH3COOH; X có dạng là CH3COOR

Y + O2 → Y1 nên Y có thể là CH3CHO.

Có 2 chất X thỏa mãn là CH3COOCH=CH2 và CH3COOCH(OH)CH3

Câu 20: Đáp án C

[C6H7O2(OH)3]n + 3nHNO3 → [C6H7O2(ONO2)3]n + 3nH2O

Ta có:

nxenlulozo = ntrinitrat xenlulozo = Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1)

mxenlulozo = Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1) . 162n = 54545g = 545,45kg

Câu 21: Đáp án C

Ta có MX = 100 ⇒ X có công thức phân tử C5H8O2

Ta có nX = 10 : 100 = 0,1 mol < nNaOH = 0,15 mol ⇒ chất rắn khan chứa muối RCOONa : 0,1 mol và NaOH dư: 0,05 mol

⇒ 0,1. (R + 67) + 0,05. 40 = 11,6 ⇒ R = 29 (C2H5)

Vậy X có công thức C2H5COOCH=CH2. Khi thủy phân X thu được C2H5COONa và CH3CHO

Câu 22: Đáp án B

Hợp chất saccarozơ thuộc loại đisaccarit, phân tử này được cấu tạo bởi 1 gốc α– glucozo, 1 gốc β– fructozo

Câu 23: Đáp án A

nCH3COOC6H5 = 0,1 mol; nNaOH = 0,25 mol

CH3COOC6H5 + 2NaOH → CH3COONa + C6H5ONa + H2O

nNaOH dư = 0,25 – 0,1 x 2 = 0,05 mol

Sau phản ứng thu được chất rắn gồm 0,1 mol CH3COONa; 0,1 mol C6H5ONa và 0,05 mol NaOH dư.

Vậy m = 0,1. 82 + 0,1.116 + 0,05.40 = 21,8 gam

Câu 24: Đáp án A

Khi nhỏ I2 vào các dung dịch glucozơ, saccarozơ, CH3CHO, ancol etylic, hồ tinh bột. Dịch xuất hiện xanh tím là hồ tinh bột.

Khi cho các dung dịch saccarozơ, CH3CHO, ancol etylic vào Cu(OH)2. Ở nhiệt độ thường dung dịch saccarozơ hòa tan kết tủa tạo dung dịch màu xanh lam, hai ống nghiệm còn lại không hiện tượng.

Đun nóng hai ống nghiệm còn lại, có kết tủa đỏ gạch → CH3CHO.

Không hiện tượng → C2H5OH.

Câu 25: Đáp án D

Từ 4 đáp án, ta xác định được ngay X là axit và Y là este.

Este Y được tạo thành từ axit X và 1 ancol no đơn chức (CnH2n+1OH)

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1)

Gọi x và n lần lượt là số mol và số nguyên tử C của ancol.

Ta có:

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1)

Vậy công thức của X là CH2=CHCOOH, công thức của Y: CH2=CHCOOC2H5

Câu 26: Đáp án A

Nhận thấy cho hỗn hợp glucozơ và fructozơ vào Br2 chỉ có glucozơ tham gia phản ứng

nglucozơ = nBr2 = 0,05 mol

Cho hỗn hợp glucozơ và fructozơ phản ứng H2 thì nglucozơ + nfructozơ = 0,2 mol

⇒ nfructozơ = 0,15 mol.

Câu 27: Đáp án A

nH2O bay hơi = 0,1 mol

Nung muối trong oxi dư thu được:

nNa2CO3 = 0,075 mol; nCO2 = 0,325 mol; nH2O = 0,175 mol.

nNaOH = 2.nNa2CO3 = 2.0,075 = 0,15 mol.

nC trong X = nNa2CO3 + nCO2 = 0,075 + 0,325 = 0,4 mol.

Bảo toàn H trong X: nH trong X = 0,1.2 + 0,175.2 – 0,15 = 0,4.

Theo BTKL: a = 11,8 + 1,8 – 0,15.40 = 7,6 gam

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1)

Giả sử X là CxHyOz

Vậy x : y : z = 0,4 : 0,4 : 0,15 = 8 : 8 : 3

Vậy CTĐGN của X là C8H8O3

Câu 28: Đáp án B

C6H12O6 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1) 2C2H5OH + 2CO2

CH3CH2OH + O2 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1) CH3COOH + H2O

nglucozơ = 1 ⇒ nC2H5OH = 1.2.0,8 = 1,6 mol

nCH3COOH (lt) = 0,1.0,16 = 0,16 mol

nCH3COOH (tt) = 0,72.0,2 = 0,144 mol

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 1)

Câu 29: Đáp án B

Hỗn hợp X gồm hai chất hữu cơ đơn chức.

X + 0,5 mol KOH → muối của hai axit cacboxylic đơn chức và 1 ancol đơn chức

ancol + Na dư → 0,15 mol H2.

• nKOH = 0,5 mol

nancol = 2nH2 = 2.0,15 = 0,3 mol < nKOH

Chỉ có 1 chất phản ứng sinh ra rượu.

Mà thu được 2 muối ⇒ Có một chất là este và 1 chất là axit

Câu 30: Đáp án D

Trong công nghiệp người ta dùng glucozơ để chế tạo ruột phích.

Quảng cáo

Phòng Giáo dục và Đào tạo .....

Đề thi Giữa học kì 1

Môn: Hóa Học 12

Thời gian làm bài: 45 phút

(Đề 2)

Câu 1: Đun nóng dung dịch chứa 27 gam glucozơ với dung dịch AgNO3/NH3(dư) thì khối lượng Ag tối đa thu được là

A. 21,6 gam     B. 32,4 gam

C. 16,2 gam     D. 10,8 gam

Câu 2: Este nào sau đây khi thủy phân trong môi trường kiềm tạo ra 2 muối hữu cơ?

A. C6H5COOCH2CH=CH2.

B. CH2=CHCH2COOC6H5.

C. CH3COOCH=CHC6H5.

D. C6H5CH2COOCH=CH2.

Câu 3: Hỗn hợp A gồm glucozơ và tinh bột được chia thành hai phần bằng nhau. Phần thứ nhất được khuấy trong nước, lọc và cho nước lọc phản ứng với dung dịch AgNO3(dư)/ NH3 thấy tách ra 2,16 gam Ag. Phần thứ hai được đun nóng với dung dịch H2SO4 loãng, trung hoà hỗn hợp thu được bằng dung dịch NaOH rồi cho sản phẩm tác dụng với dung dịch AgNO3(dư)/ NH3 thấy tách ra 6,48 gam Ag. Giả sử các phản ứng xảy ra hoàn toàn. Phần trăm khối lượng mỗi chất trong hỗn hợp ban đầu là

A. 64,29% glucozơ và 35,71% tinh bột.

B. 64,71% glucozơ và 35,29% tinh bột.

C. 35,29% glucozơ và 64,71% tinh bột.

D. 35,71% glucozơ và 64,29% tinh bột.

Câu 4: Mệnh đề nào sau đây không đúng?

A. Metyl fomat có CTPT là C2H4O2.

B. Metyl fomat là este của axit etanoic.

C. Metyl fomat có thể tham gia phản ứng tráng bạc.

D. Thuỷ phân metyl fomat tạo thành ancol metylic và axit fomic.

Câu 5: Cho dãy các chất: glucozơ; xenlulozơ; saccarozơ; tinh bột; mantozơ. Số chất trong tham gia phản ứng tráng gương là

A. 3     B. 5

C. 4     D. 2

Câu 6: Nhiệt độ sôi của các chất được sắp xếp theo thứ tự tăng dần đúng là

A. C2H5Cl < CH3COOH < C2H5OH.

B. C2H5Cl < CH3COOCH3 < C2H5OH < CH3COOH.

C. CH3OH < CH3CH2OH < NH3 < HCl.

D. HCOOH < CH3OH < CH3COOH < C2H5F.

Câu 7: Khí CO2 chiếm 0,03 % thể tích không khí. Thể tích không khí (ở đktc) để cung cấp CO2 cho phản ứng quang hợp để tạo ra 27 gam glucozơ là

A. 44800 lít     B. 672 lít

C. 67200 lít     D. 448 lít

Câu 8: Este mạch hở X có CTPT là C4H6O2. Số đồng phân tối đa có thể có của X là

A. 3.     B. 4.

C. 5.     D. 6.

Câu 9: Xenlulozơ không phản ứng được với chất nào sau đây:

A. HNO3 đặc trong H2SO4 đặc, đun nóng

B. H2 có Ni xúc tác, đun nóng

C. Cu(OH)2 trong dung dịch NH3

D. CS2 trong dung dịch NaOH

Câu 10: Chất hữu cơ X mạch hở có CTPT C4H6O2, biết rằng:

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 2)

CTCT của X là

A. CH2=CH-CH2-COOH.

B. CH2=CHCOOCH3.

C. HCOOCH2–CH=CH2.

D. CH3COOCH=CH2.

Câu 11: Để phân biệt các dung dịch glucozơ, saccarozơ và anđehit axetic có thể dùng dãy chất nào sau đây làm thuốc thử?

A. Nước brom và NaOH

B. AgNO3/NH3 và NaOH

C. Cu(OH)2 và AgNO3/NH3

D. HNO3 và AgNO3/NH3

Câu 12: Hai este X, Y là dẫn xuất của benzen, đều có CTPT là C9H8O2; X và Y đều cộng hợp với Brom theo tỉ lệ mol 1:1. X tác dụng với dung dịch NaOH cho một muối và một anđehit. Y tác dụng với dung dịch NaOH dư cho 2 muối và nước, các muối đều có phân tử khối lớn hơn phân tử khối của CH3COONa. CTCT của X và Y lần lượt là

A. HOOC-C6H4-CH=CH2 và CH2=CH-COOC6H5.

B. C6H5COOCH=CH2 và C6H5-CH=CH-COOH.

C. HCOO-C6H4-CH=CH2 và HCOOCH=CH-C6H5.

D. C6H5COO-CH=CH2 và CH2=CH-COOC6H5.

Câu 13: Để chứng minh trong phân tử của glucozơ có nhiều nhóm hiđroxyl, người ta cho dung dịch glucozơ phản ứng với

A. kim loại Na

B. Cu(OH)2 ở nhiệt độ thường.

C. AgNO3 (hoặc Ag2O) trong dung dịch NH3, đun nóng

D. Cu(OH)2 trong NaOH, đun nóng.

Câu 14: Cho các chất: etyl axetat, ancol etylic, axit acrylic, phenol, phenyl amoni clorua, ancol benzylic, p-crezol. Trong các chất này, số chất tác dụng được với dung dịch NaOH là

A. 4.     B. 6.

C. 5.     D. 3.

Câu 15: Thủy phân 171g mantozơ với hiệu suất 50% thu được dd X. Sau khi trung hòa axit dư trong X thu được dd Y. Cho Y tác dụng với AgNO3/NH3 dư thu được a gam Ag. Giá trị a là

A. 108     B. 216

C. 162     D. 270

Câu 16: Cho sơ đồ chuyển hóa:

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 2)

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 2)

Tên gọi của Y là:

A. propan-1,3-điol.

B. propan-1,2-điol.

C. propan-2-ol.

D. glixerol.

Câu 17: Cho các chất: X: glucozơ; Y: Saccarozơ; Z: Tinh bột; T: Glixerin; H: Xenlulozơ. Những chất bị thuỷ phân là

A. X , Z , H

B. Y , Z , H

C. X , Y , Z

D. Y , T , H

Câu 18: Ba hợp chất hữu cơ mạch hở X, Y, Z có cùng công thức phân tử C3H6O2 và có các tính chất sau: X, Y đều tham gia phản ứng tráng bạc; X, Z đều tác dụng được với dung dịch NaOH. Các chất X, Y, Z lần lượt là

A. CH2(OH)-CH2-CHO, C2H5-COOH, CH3-COO-CH3.

B. HCOO-C2H5, CH3-CH(OH)-CHO, OHC-CH2-CHO.

C. CH3-COO-CH3, CH3-CH(OH)-CHO, HCOO-C2H5.

D. HCOO-C2H5, CH3-CH(OH)-CHO, C2H5-COOH.

Câu 19: Thủy phân 1kg khoai (chứa 20% tinh bột) trong môi trường axit. Nếu hiệu suất phản ứng là 75% thì lượng glucozơ thu được là

A. 200g     B. 166,6g

C. 150g     D. 120g

Câu 20: Dãy nào sau đây sắp xếp các chất theo trật tự tăng dần nhiệt độ sôi?

A. HCOOCH3 < CH3COOCH3 < C3H7OH < CH3COOH < C2H5COOH

B. CH3COOCH3 < HCOOCH3 < C3H7OH < CH3COOH < C2H5COOH

C. HCOOCH3 < CH3COOCH3 < C3H5OH < C2H5COOH < CH3COOH

D. C2H5COOH < CH3COOH < C3H7OH < CH3COOCH3 < HCOOCH3

Câu 21: Thủy phân hoàn toàn 1kg saccarozơ sẽ thu được

A. 0,5kg glucozơ và 0,5kg fructozơ.

B. 1kg glucozơ và 1kg fructozơ.

C. 0,5263kg glucozơ và 0,5263kg fructozơ

D. 2kg glucozơ.

Câu 22: Thủy phân 4,3 gam este X đơn chức mạch hở (có xúc tác axit) đến khi phản ứng hoàn toàn thu được hỗn hợp hai chất hữu cơ Y và Z. Cho Y, Z phản ứng với dung dịch dư AgNO3/NH3 thu được 21,6 gam bạc. Công thức cấu tạo của X là:

A. CH3COOCH=CH2.

B. HCOOCH=CH-CH3.

C. HCOOCH2CH=CH2.

D. HCOOC(CH3)=CH2.

Câu 23: Cho sơ đồ phản ứng: Thuốc súng không khói ← X → Y → Sobitol. X , Y lần lượt là:

A. xenlulozơ, fructozơ.

B. xenlulozơ, glucozơ.

C. tinh bột, glucozơ.

D. saccarozơ, glucozơ.

Câu 24: Cho 10,2 gam một este đơn chức X tác dụng vừa đủ với 40 gam dung dịch NaOH 15%. Số đồng phân cấu tạo thỏa mãn điều kiện trên của X là

A. 3.     B. 4.

C. 5.     D. 6.

Câu 25: Xenlulozơ trinitrat được điều chế từ Xenlulozơ và axít HNO3 đặc (có xúc tác H2SO4 đặc nóng). Để có 29,7 kg Xenlulozơ trinitrat cần dùng dung dịch chứa m kg HNO3 (H = 90%). Tính m

A. 21kg     B. 17,01kg

C. 18,9kg     D. 22,5kg

Câu 26: Chất X có công thức phân tử C4H6O2. Cho m gam X phản ứng vừa đủ với dung dịch chứa 2 gam NaOH, tạo ra 4,1 gam muối. Kết luận nào sau đây là đúng cho chất X ?

A. X có phản ứng tráng bạc và có làm mất màu nước brom

B. X có khả năng làm đổi màu quỳ tím thành đỏ

C. X không tham gia phản ứng tráng bạc nhưng có làm mất màu nước brom

D. X có phản ứng tráng bạc nhưng không làm mất màu nước brom

Câu 27: Một dung dịch có tính chất sau :

- Tác dụng được với dung dịch AgNO3/NH3 và Cu(OH)2 khi đun nóng.

- Hòa tan được Cu(OH)2 tạo ra dung dịch màu xanh lam.

- Bị thủy phân nhờ axit hoặc enzim.

Dung dịch đó là:

A. Glucozơ

B. Mantozơ

C. Saccarozơ

D. Xenlulozơ

Câu 28: Khi thuỷ phân 0,1 mol este X được tạo bởi một ancol đa chức với một axit cacboxylic đơn chức cần dùng vừa đủ 12 gam NaOH. Mặt khác để thuỷ phân 6,35 gam X cần dùng 3 gam NaOH và thu được 7,05 gam muối. Công thức của X là:

A. (CH3COO)3C3H5

B. (HCOO)3C3H5

C. (C2H3COO)3C3H5

D. (CH3COO)2C2H4

Câu 29: Có thể dùng Cu(OH)2 để phân biệt được các chất trong nhóm nào sau đây?

A. C3H5(OH)3, C2H4(OH)2

B. C3H7OH, CH3CHO

C. CH3COOH, C2H3COOH

D. C3H5(OH)3, C12H22O11 (saccarozơ)

Câu 30: X là một este đơn chức không tham gia phản ứng tráng bạc, khi thủy phân hoàn toàn 4,3 gam X bằng dung dịch NaOH vừa đủ rồi chưng cất sản phẩm được muối Y và phần bay hơi Z. Cho Z phản ứng với Cu(OH)2 dư trong điều kiện thích hợp thu được 7,2 gam kết tủa đỏ gạch. Khối lượng của muối thu được là

A. 3,4 gam     B. 6,8 gam

C. 3,7 gam     D. 4,1 gam

Đáp án & Thang điểm

Câu 1: Đáp án B

Trong phản ứng tráng gương cứ 1 mol glucozơ → 2 mol Ag

nglucozơ = 0,15 mol ⇒ nAg = 0,3 mol

⇒ mAg = 0,3.108 = 32,4g.

Câu 2: Đáp án B

C6H5COOCH2CH=CH2 + NaOH → C6H5COONa + CH2=CH-CH2OH

CH2=CHCH2COOC6H5 + 2NaOH → CH2=CHCOONa + C6H5ONa + H2O

CH3COOCH=CHC6H5 + NaOH → CH3COONa + C6H5CH2CHO

C6H5CH2COOCH=CH2 + NaOH → C6H5CH2COONa + CH3CHO

Câu 3: Đáp án D

Phần 1: chỉ có glucozơ tham gia phản ứng tráng gương

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 2)

⇒ nglucozo = 1/2 nAg = 0,01 mol

Phần 2:

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 2)

Câu 4: Đáp án B

Đáp án B sai vì metyl fomat là este của axit fomic.

Câu 5: Đáp án D

Các chất tham gia phản ứng tráng gương là: glucozơ và mantozơ.

Câu 6: Đáp án B

Đáp án A sai vì C2H5Cl < C2H5OH < CH3COOH.

Đáp án B thỏa mãn.

Đáp án C sai vì NH3 < CH3OH < CH3CH2OH < HCl

Đáp án D sai vì C2H5F < CH3OH < HCOOH < CH3COOH

Câu 7: Đáp án C

nglucozơ = 27:180 = 0,15 mol

6CO2 + 6H2O -as→ C6H12O6 + 6O2

⇒ nCO2 cần = 0,15.6 = 0,9 mol

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 2)

Câu 8: Đáp án D

Este mạch hở X có CTPT là C4H6O2 (k = π + v = 2)

Các đồng phân thỏa mãn gồm HCOOCH=CH-CH3(1), HCOOCH2-CH=CH2 (2), HCOOC(CH3)=CH2(3), CH3COOCH=CH2 (4), CH2=CH-COOCH3 (5)

Chú ý (1) có đồng phân hình học. Vậy có 6 đồng phân thỏa mãn.

Câu 9: Đáp án B

Xenlulozơ không tác dụng với H2/Ni, toC.

Câu 10: Đáp án B

Muối Y + NaOH Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 2) CH2=CH2

Mà X có CTPT là C4H6O2 ⇒ Y là CH2=CHCOONa.

⇒ X là CH2=CHCOOCH3 ⇒ Chọn B.

CH2=CHCOOCH3 + NaOH → CH2=CHCOONa (Y) + CH3OH

CH2=CHCOONa + NaOH Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 2) CH2=CH2 + Na2CO3.

Câu 11: Đáp án C

Dùng Cu(OH)2 để phân biệt anđehit axetic (anđehit axetic không hòa tan được Cu(OH)2 ở điều kiện thường còn saccarozơ và glucozơ hòa tan được Cu(OH)2 ở ngay điều kiện thường tạo dung dịch màu xanh lam).

Dùng AgNO3/NH3 để phân biệt glucozơ do có phản ứng tráng gương, còn saccarozơ thì không.

Câu 12: Đáp án D

Đáp án A loại vì HOOC-C6H4-CH=CH2 (X) tác dụng với NaOH cho hai muối và một nước.

• Đáp án B loại vì C6H5-CH=CH-COOH (Y) tác dụng với NaOH dư cho 1 muối và nước.

• Đáp án C loại vì HCOO-C6H4-CH=CH2 (X) tác dụng với NaOH cho hai muối và một nước;

HCOOCH=CH-C6H4 (Y) tác dụng với NaOH dư cho một muối và 1 anđehit.

• Đáp án D thỏa mãn.

C6H5COOCH=CH2 (X) + NaOH → C6H5COONa + CH3CHO

CH2=CH-COOC6H5 + 2NaOH → CH2=CH-COONa + C6H5ONa + H2O.

Câu 13: Đáp án B

Glucozơ phản ứng với Cu(OH)2 ở nhiệt độ thường tạo phức đồng xanh ⇒ chứng tỏ glucozo có nhiều nhóm hiđroxyl.

Chú ý: Glucozơ phản ứng với Na chỉ chứng minh trong phân tử có H linh động

Glucozơ phản ứng AgNO3/NH3, Cu(OH)2 trong NaOH đun nóng chứng tỏ glucozơ có nhóm -CHO.

Câu 14: Đáp án C

Có 5 chất thỏa mãn là etyl axetat, axit acrylic, phenol, phenyl amoni clorua, p-crezol.

Câu 15: Đáp án C

nmantozo = 171 : 342 = 0,5 mol

Mantozơ Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 2) 2 Glucozơ

H = 50% ⇒ nglucozơ = 0,5.2.50%= 0,5 mol

nmantozơ dư = 0,5.0,5 = 0,25 mol

nAg = 2nglucozơ + 2nmantozơ = 2.0,5 + 2.0,25 = 1,5

⇒ mAg = 1,5.108 = 162g.

Câu 16: Đáp án A

Vì E là este đa chức nên T là axit đa chức → C3H6 phải là xiclopropan (nếu là anken thì không thể tạo hợp chất đa chức)

C3H6 (xiclopropan) Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 2) CH2Br-CH2-CH2Br Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 2) CH2OH-CH2-CH2OH Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 2) HOC-CH2-CHO Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 2) HOOC-CH2-COOH Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 2) CH3OOC-CH2-COOCH3

Câu 17: Đáp án B

Những chất tham gia phản ứng thủy phân gồm đisaccarit và polisaccarit

Vậy Y: Saccarozơ; Z: Tinh bột; H: Xenlulozơ bị thủy phân.

Câu 18: Đáp án D

Đáp án A loại vì C2H5-COOH (Y) không tham gia phản ứng tráng bạc.

Đáp án B loại vì OHC-CH2-CHO (Z) không tác dụng được với dung dịch NaOH.

Đáp án C loại vì CH3COOCH3 (X) không tham gia phản ứng tráng bạc.

Đáp án D thỏa mãn.

Câu 19: Đáp án B

Khối lượng tinh bột có trong 1kg khoai là 0,2kg

(C6H10O5)n + nH2O Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 2) nC6H12O6 (H = 75%)

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 2)

mC6H12O6 = 0,926.180 = 166,6g

Câu 20: Đáp án A

Nhận thấy C3H7OH, CH3COOH, C2H5COOH là hợp chất có liên kết hiđro (nhóm I), HCOOCH3 và CH3COOCH3 là hợp chất không có liên kết hiđro (nhóm II)

→ ts của nhóm I > ts của nhóm II.

So sánh các chất trong nhóm I:

+ Trong - COOH có nhóm C=O làm liên kết hiđro của các hợp chất có nhóm COOH bền hơn → ts(CH3COOH, C2H5COOH) > ts (C3H7OH)

+ C2H5COOH có phân tử khối lớn hơn CH3COOH → ts (C2H5COOH) > ts (CH3COOH)

So sánh các chất trong nhóm II.

CH3COOCH3 có phân tử khối lớn hơn HCOOCH3

→ ts CH3COOCH3 > t HCOOCH3

Vậy nhiệt độ sôi sắp xếp theo thứ tự HCOOCH3 < CH3COOCH3 < C3H7OH < CH3COOH < C2H5COOH.

Câu 21: Đáp án C

C12H22O11 + H2O → C6H12O6(glucozơ) + C6H12O6 (fructozơ)

Ta có:

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 2)

Câu 22: Đáp án B

nAg = 0,2

Nếu chỉ có 1 chất (Y hoặc Z) tác dụng với AgNO3:

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 2)

Nếu cả Y và Z đều tác dụng

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 2)

Do cả 2 chất đều tác dụng nên CTCT của X là:

Câu 23: Đáp án B

Thuốc súng không khói có thành phần xenlulozo nitrat ⇒ X là xenlulozơ

Thuốc súng không khói ← Xenlulozơ Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 2) glucozơ Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 2) Sobitol

Câu 24: Đáp án B

nX = nNaOH = 0,15 mol → MX = 13,2 : 0,15 = 88 → X là C4H8O2.

Có 4 CTCT thỏa mãn là HCOOCH2CH2CH3, HCOOCH(CH3)2, CH3COOCH2CH3, CH3CH2COOCH3.

Câu 25:

[C6H7O2(OH)3]n + 3n HNO3 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 2) [C6H7O2(ONO2)3]n + 3n H2O (H = 90%)

Với H = 90%

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 2)

Câu 26: Đáp án C

nNaOH = 0,05 mol.

Giả sử muối là RCOONa

nRCOONa = 0,05 mol ⇒ MRCOONa = 4,1 : 0,05 = 82 ⇒ MR = 15 ⇒ Muối là CH3COONa

Vậy X là CH3COOCH=CH2.

Đáp án A sai vì X không có phản ứng tráng bạc.

Đáp án B sai vì X không làm quỳ tím đổi màu.

Đáp án C thỏa mãn.

Đáp án D sai vì X không có phản ứng tráng bạc nhưng làm mất màu nước brom

Câu 27: Đáp án B

Glucozơ là monosaccarit, là nhóm cacbohiđrat đơn giản nhất, không thể thủy phân được ⇒ loại A

Saccarozơ không có nhóm –OH hemiaxetal nên không có khả năng mở vòng tạo nhóm –CHO ⇒ Saccarozơ không phản ứng với dd AgNO3/NH3 và Cu(OH)2 đun nóng ⇒ Loại C

Xenlulozơ là poliancol, tuy còn nhiều nhóm –OH kề nhau nhưng trong cấu trúc polime, nhóm –OH mất linh động nên không tác dụng với Cu(OH)2 tạo dung dịch màu xanh lam ⇒ Loại D

Câu 28: Đáp án C

0,1 mol este X + 0,3 mol NaOH ⇒ X là este 3 chức.

6,35 gam X + 0,075 mol NaOH ⇒ 7,05 gam muối

nX = 0,075 : 3 = 0,025 mol, nancol = 0,025 mol

Theo BTKL: mancol = 6,35 + 3 - 7,05 = 2,3 gam

⇒ Mancol = 2,3 : 0,025 = 92 ⇒ glyxerol

⇒ X có dạng (RCOO)3C3H5

MX = 6,35 : 0,025 = 254 ⇒ MR = 27 ⇒ R là C2H3-

Vậy X là (C2H3COO)3C3H5

Câu 29: Đáp án D

Dùng Cu(OH)2 để phân biệt C3H7OH, CH3CHO khi đun nóng CH3CHO tạo chất kết tủa màu đỏ gạch; C3H7OH không hiện tượng.

Câu 30: Đáp án D

Z + Cu(OH)2 → 0,05 mol ↓Cu2O

Vậy Z là anđehit (Z có số C ≥ 2 vì Z là sản phẩm của phản ứng thủy phân X)

⇒ nZ = 0,05 mol.

nX = nZ = 0,05 mol ⇒ MX = 4,3 : 0,05 = 86 ⇒ X là C4H6O2.

Mà X không tham gia phản ứng tráng bạc ⇒ X là CH3COOCH=CH2

⇒ mCH3COONa = 0,05 x 82 = 4,1 gam.

Quảng cáo

Phòng Giáo dục và Đào tạo .....

Đề thi Giữa học kì 1

Môn: Hóa Học 12

Thời gian làm bài: 45 phút

(Đề 3)

Câu 1: Số đồng phân este ứng với công thức phân tử C4H8O2

A. 6.     B. 5.

C. 2.     D. 4.

Câu 2: Khi thêm vôi vào nước mía sẽ làm kết tủa các axit hữu cơ, các protit. Khi ấy saccarozơ biến thành canxi saccarat tan trong nước. Trước khi tẩy màu dung dịch bằng SO2 người ta sục khí CO2 vào dung dịch nhằm

A. Tạo môi trường axit.

B. Trung hoà lượng vôi dư.

C. Chuyển hóa saccarat thành saccarozơ.

D. Cả B và C.

Câu 3: Cho các phát biểu sau:

(1) Nguyên nhân làm dầu mỡ bị ôi thiu là do các liên kết pi trong gốc hiđrocacbon của axit béo không no.

(2) Các triglixerit chứa chủ yếu các gốc axit béo no thường là chất lỏng ở nhiệt độ thường

(3) Thủy phân este trong môi trường axit luôn là phản ứng thuận nghịch.

(4) Các este đều có nhiệt độ sôi cao hơn axit có cùng số nguyên tử cacbon.

(5) Các chất béo đều không tan trong nước nhưng tan nhiều trong các dung môi hữu cơ.

(6) Cho metyl axetat hoặc tristearin vào dung dịch NaOH đun nóng đều xảy ra phản ứng xà phòng hóa.

Số phát biểu đúng là

A. 5     B. 4

C. 3     D. 2

Câu 4: Glucozơ lên men thành ancol etylic, toàn bộ khí sinh ra được dẫn vào dung dịch Ca(OH)2 dư tách ra 40 gam kết tủa, biết hiệu suất lên men đạt 75%. Khối lượng glucozơ cần dùng là

A. 24 gam     B. 40 gam

C. 50 gam     D. 48 gam

Câu 5: Cho glixerol tác dụng với hỗn hợp ba axit C17H35COOH, C17H33COOH và C15H31COOH. Số loại trieste có thể được tạo thành chứa hai gốc axit trong số ba axit béo trên là

A. 9     B. 6

C. 12     D. 10

Câu 6: Lượng glucozơ dùng để tạo ra 1,82 gam sobitol với hiệu suất 80% là

A. 2,250 gam     B. 1,440 gam

C. 1,125 gam     D. 2,880 gam

Câu 7: Cho các phát biểu sau:

(a) Chất béo được gọi chung là triglixerit hay triaxylglixerol.

(b) Chất béo nhẹ hơn nước, không tan trong nước nhưng tan nhiều trong dung môi hữu cơ.

(c) Phản ứng thủy phân chất béo trong môi trường axit là phản ứng thuận nghịch.

(d) Tristearin, triolein có công thức lần lượt là: (C17H35COO)3C3H5, (C17H33COO)3C3H5.

Số phát biểu đúng là

A. 4     B. 1

C. 3     D. 2

Câu 8: Dãy gồm các chất đều tác dụng với Cu(OH)2

A. Glucozơ, glixerin, mantozơ, axit axetic

B. Glucozơ, glixerin, mantozơ, natri axetat

C. Glucozơ, glixerin, anđehitfomic, natri axetat.

D. Glucozơ, glixerin, mantozơ, ancol etylic.

Câu 9: Hợp chất CH3(CH2)7CH=CH(CH2)7COOCH3 có tên gọi là

A. Metyl oleat

B. Metyl panmitat

C. Metyl stearat

D. Metyl acrylat

Câu 10: Ở trạng thái sinh lí bình thường, glucozơ trong máu người chiếm một tỉ lệ không đổi là:

A. 1,0 %     B. 0,01 %

C. 0,1 %     D. 10 %

Câu 11: Mệnh đề không đúng là

A. CH3CH2COOCH=CH2 cùng dãy đồng đẳng với CH2=CHCOOCH3.

B. CH3CH2COOCH=CH2 tác dụng với dung dịch NaOH thu được anđehit và muối.

C. CH3CH2COOCH=CH2 tác dụng được với dung dịch Br2.

D. CH3CH2COOCH=CH2 có thể trùng hợp tạo polime.

Câu 12: Glucozơ có ứng dụng nào sau đây: (1) tiêm truyền ; (2) sản xuất kính xe ; (3) tráng gương ; (4) tráng ruột phích ; (5) nguyên liệu sản xuất ancol etylic?

A. (1) ; (3) ; (4) ; (5)

B. (3) ; (4) ; (5)

C. (1) ; (3) ; (4)

D. (1) ; (2) ; (3) ; (4)

Câu 13: Phát biểu đúng là

A. Phản ứng thủy phân este trong môi trường axit là phản ứng thuận nghịch.

B. Phản ứng giữa axit và ancol khi có H2SO4 đặc là phản ứng một chiều.

C. Tất cả các este phản ứng với dung dịch kiềm luôn thu được sản phẩm cuối cùng là muối và ancol.

D. Khi thủy phân chất béo luôn thu được C2H4(OH)2.

Câu 14: Chia 200 gam dung dịch hỗn hợp glucozơ và fructozơ thành hai phần bằng nhau:

• Phần 1: Tác dụng với dung dịch AgNO3 trong NH3 dư thu được 86,4 gam Ag kết tủa

• Phần 2: Phản ứng vừa hết với 28,8 gam Br2 trong dung dịch.

Nồng độ phần trăm của fructozơ trong dung dịch ban đầu là

A. 39,6 %     B. 16,2 %

C. 25,5 %     D. 33,3 %

Câu 15: Cho glixerin trioleat (hay triolein) lần lượt vào mỗi ống nghiệm chứa riêng biệt: Na, Cu(OH)2, CH3OH, dung dịch Br2, dung dịch NaOH. Trong điều kiện thích hợp, số phản ứng xảy ra là

A. 4     B. 2

C. 3     D. 5

Câu 16: Nhóm chất đều tác dụng với dung dịch AgNO3/NH3

A. C3H5(OH)3, glucozơ, CH3CHO, C2H2

B. C2H2, C2H4, C2H6, HCHO

C. Glucozơ, C2H2, CH3CHO, HCOOH

D. C2H2, C2H5OH, glucozơ, HCOOH

Câu 17: Hợp chất hữu cơ mạch hở X có công thức phân tử C6H10O4. Thuỷ phân X tạo ra hai ancol đơn chức có số nguyên tử cacbon trong phân tử gấp đôi nhau. Công thức của X là

A. CH3OCO-CH2-COOC2H5.

B. C2H5OCO-COOCH3.

C. CH3OCO-COOC3H7.

D. CH3OCO-CH2-CH2-COOC2H5.

Câu 18: Lên men 162 gam tinh bột với hiệu suất các quá trình lên men lần lượt là 80% và 90%. Biết khối lượng riêng của C2H5OH nguyên chất là 0,8 g/ml. Thể tích dung dịch rượu 40o thu được là

A. 115 ml.     B. 230 ml.

C. 207 ml.     D. 82,8 ml.

Câu 19: Este X có các đặc điểm sau:

- Đốt cháy hoàn toàn X tạo thành CO2 và H2O có số mol bằng nhau;

- Thuỷ phân X trong môi trường axit được chất Y (tham gia phản ứng tráng gương) và chất Z (có số nguyên tử cacbon bằng một nửa số nguyên tử cacbon trong X).

Phát biểu không đúng là

A. Chất X thuộc loại este no, đơn chức.

B. Đốt cháy hoàn toàn 1 mol X sinh ra sản phẩm gồm 2 mol CO2 và 2 mol H2O.

C. Chất Y tan vô hạn trong nước.

D. Đun Z với dung dịch H2SO4 đặc ở 170oC thu được anken.

Câu 20: Glucozơ có thể tạo ra este chứa 5 gốc axit trong phân tử. Este chứa 5 gốc axit axetic của glucozơ có công thức phân tử nào dưới đây:

A. C16H22O11     B. C16H24O12

C. C16H24O10     D. C11H10O8

Câu 21: Thuỷ phân chất hữu cơ X trong dung dịch NaOH (dư), đun nóng, thu được sản phẩm gồm 2 muối và ancol etylic. Chất X là

A. CH3COOCH2CH3.

B. CH3COOCH2CH2Cl.

C. CH3COOCH(Cl)CH3.

D. ClCH2COOC2H5.

Câu 22: Dãy gồm các chất tham gia phản ứng thuỷ phân (trong điều kiện thích hợp) là

A. protit, glucozơ, sáp ong, mantozơ.

B. poli stiren, tinh bột, steroit, saccarozơ.

C. xenlulozơ, mantozơ, fructozơ.

D. xenlulozơ, tinh bột, chất béo

Câu 23: Cho chất X tác dụng với một lượng vừa đủ dung dịch NaOH, sau đó cô cạn dung dịch thu được chất rắn Y và chất hữu cơ Z. Cho Z tác dụng với AgNO3 trong dung dịch NH3 thu được chất hữu cơ T. Cho chất T tác dụng với dung dịch NaOH lại thu được chất Y. Chất X có thể là

A. HCOOCH3.

B. HCOOCH=CH2.

C. CH3COOCH=CH-CH3.

D. CH3COOCH=CH2.

Câu 24: Từ 180 gam glucozơ, bằng phương pháp lên men rượu, thu được a gam ancol etylic (hiệu suất 80%). Oxi hoá 0,1a gam ancol etylic bằng phương pháp lên men giấm, thu được hỗn hợp X. Để trung hoà hỗn hợp X cần 720 ml dung dịch NaOH 0,2M. Hiệu suất quá trình lên men giấm là

A. 80%     B. 10%

C. 90%     D. 20%

Câu 25: Chất X có công thức phân tử CxHyOz. Cho X tác dụng với NaOH thu được Y và Z. Biết Z không tác dụng được với Na và có sơ đồ chuyển hóa sau:

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 3)

Thành phần phần trăm theo khối lượng của cacbon trong X là

A. 55,81%.     B. 48,65%.

C. 40,00%.     D. 54,55%.

Câu 26: Cho sơ đồ sau: glucozơ → X → Y → anđehit axetic. Tên của Y là:

A. anđehit fomic     B. etilen

C. axit propionic    D. etanol

Câu 27: Cho 10 gam chất X (chỉ chứa nhóm chức este có phân tử khối là 100 đvC) tác dụng với 150 ml dung dịch NaOH 1M. Sau phản ứng, cô cạn dung dịch thu được 11,6 gam chất rắn khan và một chất hữu cơ Y. Công thức của Y là

A. CH3OH.     B. C2H5OH.

C. CH3CHO.     D. CH3COCH3.

Câu 28: Khẳng định nào sau đây đúng?

A. Saccarozơ và mantozơ là đồng phân của nhau

B. Tinh bột và xenlulozơ là đồng phân của nhau

C. Fructozơ khong tham gia phản ứng tráng bạc trong dung dịch AgNO3 trong NH3

D. Saccarozơ và mantozơ không cho phản ứng thủy phân

Câu 29: Cho 10,2 gam một este đơn chức X tác dụng vừa đủ với 40 gam dung dịch NaOH 15%. Số đồng phân cấu tạo thỏa mãn điều kiện trên của X là

A. 3     B. 4

C. 5     D. 6

Câu 30: Đem glucozơ lên men điều chế ancol etylic (khối lượng riêng của ancol etylic nguyên chất là 0,8 g/ml), hiệu suất phản ứng lên men ancol etylic là 75%. Để thu được 80 lít rượu vang 120 thì khối lượng glucozơ cần dùng là

A. 24,3 (kg)     B. 20(kg)

C. 21,5(kg)     D. 25,2(kg).

Đáp án & Thang điểm

Câu 1: Đáp án D

HCOO-CH2-CH2-CH3

HCOO-CH(CH3)-CH3

CH3COO-CH2-CH3

C2H5COO-CH3

⇒ Có 4 đồng phân.

Câu 2: Đáp án D

C12H22O11 + Ca(OH)2 → C12H22O11.CaO.H2O

C12H22O11.CaO.H2O + CO2 → C12H22O11 + CaCO3↓ + 2H2O

CO2 + Ca(OH)2 → CaCO3↓ + H2O

Câu 3: Đáp án B

Nguyên nhân làm dầu mỡ bị ôi thiu là do liên kết πC=C bị oxi hóa chậm bởi oxi không khí tạo thành peoxit, chất này bị phân hủy thành các sản phẩm có mùi khó chịu → (1) đúng

Các triglixerit chứa chủ yếu các gốc axit béo no thường là chất rắn ở nhiệt độ thường → (2) sai

Phản ứng thủy phân este trong axit là thuận nghịch, phản ứng thủy phân trong môi trường kiềm là phản ứng 1 chiều → (3) đúng

Các axit tồn tại liên kết hiđro, este không chứa liên kết hiđro nên các este đều có nhiệt độ sôi thấp hơn axit có cùng số nguyên tử cacbon → (4) sai

Chất béo là trieste của glixerol và axit béo → chất béo là hợp chất không phân cực, không tan trong nước nhưng tan nhiều trong các dung môi hữu cơ → (5) đúng

Phản ứng thủy phân este trong môi trường kiềm là phản ứng xà phòng hóa → (6) đúng

Câu 4: Đáp án D

C6H12O6 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 3) 2C2H5OH + 2CO2

CO2 + Ca(OH)2 → CaCO3↓ + H2O.

Ta có nCO2 = nCaCO3 = 0,4 mol

H = 75%

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 3)

Câu 5: Đáp án C

Chọn 2 trong 3 axit có = 3 cách chọn

Có 4 cách sắp xếp trieste tạo bởi axit A,B và glixerol.

( A – A - B, A – B - A, B – B - A, B – A - B)

Số loại trieste có thể được tạo thành chứa hai gốc axit trong số ba axit béo trên là: 3. 4 = 12.

Câu 6: Đáp án A

CH2OH[CHOH]4CHO + H2 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 3) CH2OH[CHOH]4CH2OH (H = 80%)

Với H = 80% thì nglucozơ = nsobitol/80% = 0,0125 mol

⇒ mglucozơ = 0,0125.180 = 2,25 gam.

Câu 7: Đáp án A

Câu 8: Đáp án A

Nhận thấy muối natri axetat và ancol etylic không phản ứng với Cu(OH)2

Câu 9: Đáp án A

Giả sử este là RCOOR'.

Tên este gồm: tên gốc hiđrocacbon R' + tên anion gốc axit (đuôi "at")

Metyl oleat là CH3(CH2)7CH=CH(CH2)7COOCH3

Metyl panmitat là CH3(CH2)14COOCH3

Metyl stearat là CH3(CH2)16COOCH3

Metyl acrylat là CH2=CHCOOCH3.

Câu 10: Đáp án C

SGK Nâng cao trang 27 có đề cập là trong máu người trạng thái sinh lí bình thường có một lượng nhỏ glucozơ, hầu như không đổi, nồng độ khoảng 0,1%.

Câu 11: Đáp án A

Đáp án A sai. CH3CH2COOCH=CH2 có nối đôi gắn vào gốc hiđrocacbon còn CH2=CHCOOCH3 có nối đôi gắn vào anion gốc axit nên không cùng dãy đồng đẳng.

Đáp án B đúng. CH3CH2COOCH=CH2 + NaOH → CH3CH2COONa + CH3CHO

Đáp án C đúng. CH3CH2COOCH=CH2 + Br2 → CH3CH2COOCHBr-CH2Br

Đáp án D đúng. nCH3CH2COOCH=CH2 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 3) -(-CH(OCOCH2CH3)-CH2-)n-.

Câu 12: Đáp án C

Glucozơ được dùng làm tiêm truyền (có trong dung dịch truyền cho bệnh nhân)

tráng gương và tráng ruột phích dựa trên phản ứng tráng gương, là sản phẩm trung gian để sản xuất ancol etylic từ tinh bột và xenluluzơ, chứ thực tế không lấy trực tiếp glucozơ để sản xuất ancol etylic.

Câu 13: Đáp án A

Đáp án A đúng.

Đáp án B sai vì phản ứng giữa axit và ancol khi có H2SO4 đặc là phản ứng thuận nghịch.

Đáp án C sai vì ví dụ: este CH3COOCH=CH2 phản ứng với dung dịch kiềm thu được sản phẩm cuối cùng là muối và anđehit.

Đáp án D sai vì khi thủy phân chất béo luôn thu được C3H5(OH)3.

Câu 14: Đáp án A

Phần 1:

Nhận thấy cho hỗn hợp glucozơ và fructozơ phản ứng với Br2 thì chỉ có glucozơ tham gia phản ứng → nBr2 = nglucozơ = 0,18 mol.

Phần 2:

Khi tác dụng với AgNO3 trong NH3 dư thì cả glucozơ và fructozơ tham gia phản ứng

⇒ nfructozơ + nglucozơ = 1/2 nAg ⇒ nfructozơ = 1/2 .0,8 - 0,18 = 0,22 mol.

Nồng độ phần trăm của fructozơ trong dung dịch ban đầu là

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 3)

Câu 15: Đáp án B

Trong điều kiện thích hợp, triolein phản ứng được với Br2 và NaOH:

(C17H33COO)3C3H5 + 3Br2 → (C17H33Br2COO)3C3H5

(C17H33COO)3C3H5 + 3NaOH → 3C17H33COONa + C3H5(OH)3

Câu 16: Đáp án C

Nhận thấy C3H3(OH)3, C2H4, C2H5OH không tham gia phản ứng với dung dịch AgNO3/NH3.

Chú ý: Glucozơ, CH3CHO, HCOOH tham gia phản ứng tráng bạc, C2H2 tham gia phản ứng thế với dung dịch AgNO3/NH3.

Câu 17: Đáp án A

C6H10O4 có độ bất bão hòa Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 3)

Thủy phân X thu được 2 ancol đơn chức→ X là este hai chức.

Hai ancol có số C gấp đôi nhau → C1 và C2 (dựa vào đáp án)

→ X là CH3OCO-COOC2H5

Câu 18: Đáp án C

(C6H10O5)n → nC6H12O6 → 2nC2H5OH .

Hiệu suất toàn bộ quá trình là H = 80%.90%.100% = 72%

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 3)

Thể tích rượu C2H5OH 40o là:

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 3)

Câu 19: Đáp án D

Đốt cháy X tạo thành CO2 và H2O có số mol bằng nhau ⇒ X là este no, đơn chức.

Thủy phân X trong môi trường axit được chất Y tham gia phản ứng tráng gương ⇒ Y là HCOOH.

Z có số nguyên tử C bằng một nửa số nguyên tử cacbon trong X ⇒ X là HCOOCH3.

⇒ Đốt cháy 1 mol HCOOCH3 sinh ra sản phẩm gồm 2 mol CO2 và 2 mol H2O.

Y là HCOOH nên tan vô hạn trong nước.

Z là CH3OH nên khi đun với H2SO4 đặc ở 170oC không thu được anken.

Câu 20: Đáp án A

Phương trình phản ứng:

C6H7O(OH)5 + 5(CH3CO)2O → C6H7O(OOCCH3)5 (hay C16H22O11) + 5CH3COOH.

Ghi chú: (CH3CO)2O: anhiđrit axetic.

Câu 21: Đáp án D

CH3COOCH2CH3 + NaOH → CH3COONa + CH3CH2OH

CH3COOCH2CH2Cl + 2NaOH -to→ CH3COONa + NaCl + C2H4(OH)2

CH3COOCH(Cl)CH3 + 2NaOH → CH3COONa + NaCl + CH3CHO + H2O

ClCH2COOC2H5 + 2NaOH → HOCH2COOH + NaCl + CH3CH2OH

⇒ X thỏa mãn là ClCH2COOC2H5.

Câu 22: Đáp án D

Nhận thấy glucozơ, fructozơ, poli stiren không tham gia phản ứng thủy phân.

Câu 23: Đáp án D

RCOOR1 + NaOH → RCOONa + R1OH

Z + AgNO3 → T

T + NaOH → Y

Do đó, Z và Y cùng số nguyên tử cacbon trong phân tử.

CH3COOCH=CH2 + NaOH → CH3COONa + CH3CHO

CH3CHO + 2AgNO3 + 4NH3 + H2O → CH3COONH4 + 2Ag↓ + 2NH4NO3.

CH3COONH4 + NaOH → CH3COONa + NH3 + H2O

Câu 24: Đáp án C

Phương trình phản ứng :

C6H12O6 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 3) 2C2H5OH + 2CO2 (H = 80%)

C2H5OH + O2 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 3) CH3COOH + H2O (H1)

CH3COOH + NaOH → CH3COONa + H2O.

H = 80% ⇒ nC2H5OH = 2.nglucozơ.80% = 1,6 mol.

Lên men 0,16 mol ancol etylic thì nC2H5OH pư = nCH3COOH = nNaOH = 0,72.0,2 = 0,144 mol.

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 3)

Câu 25: Đáp án A

Ankan đơn giản nhất là CH4

Y + NaOH Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 3) CH4

Vậy Y là CH3COONa

T + NaOH → CH3COONa (Y). Vậy T là CH3COOH.

Z + O2 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 3) CH3COOH (T).

Mà Z không tác dụng với Na → Z là CH3CHO.

X + NaOH → CH3COONa (Y) + CH3CHO (Z)

Vậy X là CH3COOCH=CH2.

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 3)

Câu 26: Đáp án B

Sơ đồ phản ứng :

C6H12O6 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 3) C2H5OH Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 3) C2H4 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 3) CH3CHO

Câu 27: Đáp án C

Ta có MX = 100 ⇒ X có công thức phân tử C5H8O2

Ta có nX = 10 : 100 = 0,1 mol < nNaOH = 0,15 mol

⇒ chất rắn khan chứa muối RCOONa : 0,1 mol và NaOH dư: 0,05 mol

⇒ 0,1. (R + 67) + 0,05. 40 = 11,6 ⇒ R = 29 (C2H5)

Vậy X có công thức C2H5COOCH=CH2. Khi thủy phân X thu được C2H5COONa và CH3CHO

Câu 28: Đáp án A

Nhận thấy tinh bột và xenlulozơ có công thức tổng quát giống nhau (C6H10O5)n nhưng công thức phân tử khác nhau (do hệ số n khác nhau) ⇒ Loại B

Trong môi trường AgNO3 trong NH3 fructozơ chuyển hóa thành glucozơ nên fructozơ tham gia phản ứng tráng bạc ⇒ Loại C.

Saccarozơ và mantozơ là đisaccarit tham gia phản ứng thủy phân tạo monosacarit ⇒ Loại D

Câu 29: Đáp án B

Ta có nNaOH = 0,15 mol

Nếu X là este đơn chức của phenol ⇒ nX = 0,5nNaOH = 0,075 mol ⇒ MX = 136 (C8H8O2)

Các đồng phân thỏa mãn là HCOOC6H5-CH3 (o,p,m) và CH3COOC6H5

Nếu X là este đơn chức không chứa gốc phenol ⇒ nX = nNaOH = 0,15 mol ⇒ MX = 68. Không tìm được este đơn chức thỏa mãn.

Câu 30:

Phương trình phản ứng:

C6H12O6 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 3) 2C2H5OH + 2CO2 (H = 75%).

Ta có: mC2H5OH = V.d = (80.103.12%).0,8 = 7680 g

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 3)

Với H = 75% thì

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 3)

mglucozơ = 111,3.180 = 20034 g = 20,034 kg.

Phòng Giáo dục và Đào tạo .....

Đề thi Giữa học kì 1

Môn: Hóa Học 12

Thời gian làm bài: 45 phút

(Đề 4)

Câu 1: Nhận xét nào sau đây đúng về độ ngọt của glucozơ và fructozơ so với đường mía?

A. Cả hai đều ngọt hơn.

B. Cả hai đều kém ngọt hơn.

C. Glucozơ kém hơn, còn fructozơ ngọt hơn.

D. Glucozơ ngọt hơn, còn fructozơ kém ngọt hơn.

Câu 2: Đốt cháy hoàn toàn m gam chất béo X (chứa triglixerit của axit stearic, axit panmitic và các axit béo tự do đó). Sau phản ứng thu được 6,72 lít CO2 (đktc) và 5,22 gam nước. Xà phòng hoá m gam X (H = 90%) thì thu được khối lượng glixerol là

A. 0,414 gam     B. 1,242 gam

C. 0,828 gam     D. 0,46 gam

Câu 3: Những chất nào có phản ứng với Cu(OH)2 tạo dung dịch màu xanh lam?

A. Glucozơ và Fructozơ

B. Glucozơ và OH-CH2-CH2-CH2-OH

C. Fructozơ và ancol etylic

D. Glixerin và OH-CH2 -CH=CH2

Câu 4: Cho các chất sau: axit propionic (X), axit axetic (Y), ancol etylic (Z) và etyl propionat (T). Dãy gồm các chất được sắp xếp theo chiều tăng của nhiệt độ sôi là ?

A. Y, T, X, Z.

B. T, X, Y, Z.

C. T, Z, Y, X.

D. Z, T, Y, X.

Câu 5: Rót H2SO4 đặc vào cốc đựng chất A màu trắng thấy A dần dần chuyển sang màu vàng, sau đó chuyển sang màu nâu và cuối cùng thành một khối đen xốp, bị bọt khí đẩy lên miệng cốc. A là chất nào trong các chất sau:

A. NaCl     B. CO2 rắn

C. Saccarozơ     D. CuSO4 khan

Câu 6: Cho dãy các chất: phenyl axetat, metyl benzoat, metyl metacrylat, anlyl axetat, metyl axetat, etyl fomat, triolein, vinyl axetat, tristearin. Số chất trong dãy khi thủy phân trong dung dịch NaOH loãng (dư), đun nóng sinh ra ancol là

A. 6.     B. 7.

C. 5.     D. 8.

Câu 7: Các khí sinh ra trong thí nghiệm phản ứng của saccarozơ với dung dịch H2SO4 đặc bao gồm:

A. H2S và CO2.    B. H2S và SO2.

C. SO3 và CO2.    D. SO2 và CO2

Câu 8: Từ ancol etylic và các chất vô cơ cần thiết, ta có thể điều chế trực tiếp ra các chất nào sau đây ?

(1). Axit axetic; (2). Axetanđehit; (3). Buta-1,3-đien; (4). Etyl axetat.

A. (1), (2) và (3)

B. (1), (2) và (4)

C. (1), (3) và (4)

D. (1), (2), (3) và (4)

Câu 9: Hợp chất hữu cơ X có trong tự nhiên, khi tác dụng với hỗn hợp HNO3 và H2SO4 đặc, đun nóng tạo ra hợp chất hữu cơ Y rất dễ cháy, nổ mạnh có ứng dụng làm thuốc súng không khói. Vậy X là

A. Toluen     B. Tinh bột

C. Phenol     D. Xenlulozơ

Câu 10: Có các nhận định sau:

(1) Axit salixylic còn có tên gọi khác là axit o-hiđroxibenzoic

(2) Axit oleic và axit linoleic là đồng phân của nhau

(3) Axit axetyl salixylic tác dụng được với dung dịch NaOH theo tỉ lệ 1:2 về số mol

(4) Khi thủy phân chất béo luôn thu được glixerol.

Số nhận định sai là

A. 1     B. 4

C. 2     D. 3

Câu 11: Trong quá trình sản xuất đường mía, để tẩy màu nước đường người ta dùng khí nào sau đây?

A. CO2     B. HCl

C. SO2     D. Cl2

Câu 12: Số hợp chất là đồng phân cấu tạo, có cùng công thức phân tử C4H8O2, tác dụng được với dung dịch NaOH nhưng không tác dụng được với Na là

A. 3     B. 2

C. 4     D. 1

Câu 13: Ở động vật, tinh bột được dự trữ dưới dạng glicogen ở trong:

A. Dạ dày     B. Máu

C. Gan     D. Ruột

Câu 14: Phát biểu nào sau đây sai ?

A. Nhiệt độ sôi của este thấp hơn hẳn so với ancol có cùng phân tử khối.

B. Trong công nghiệp có thể chuyển hoá chất béo lỏng thành chất béo rắn.

C. Số nguyên tử hiđro trong phân tử este đơn và đa chức luôn là một số chẵn.

D. Sản phẩm của phản ứng xà phòng hoá chất béo là axit béo và glixerol.

Câu 15: Xenlulozơ trinitrat là chất dễ cháy và nổ mạnh, được điều chế từ xenlulozơ và axit nitric. Thể tích axit nitric 99,67% có d = 1,52g/ml cần để sản xuất 59,4 kg xenlulozơ trinitrat nếu hiệu suất đạt 90% là

A. 27,72 lít     B. 32,52 lít

C. 26,52 lít     D. 11,2 lít

Câu 16: Cho sơ đồ chuyển hoá:

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4)

Tên của Z là

A. axit oleic.

B. axit linoleic.

C. axit stearic.

D. axit panmitic.

Câu 17: Tinh bột, xenlulozơ, saccarozơ, mantozơ đều có khả năng tham gia phản ứng

A. hoà tan Cu(OH)2.

B. trùng ngưng.

C. tráng gương.

D. Thủy phân.

Câu 18: Khi đốt cháy hoàn toàn một este no, đơn chức thì số mol CO2 sinh ra bằng số mol O2 đã phản ứng. Tên gọi của este là

A. metyl fomat.

B. etyl axetat.

C. metyl axetat.

D. n-propyl axetat.

Câu 19: Cho 2,5 kg glucozơ chứa 20% tạp chất lên men thành ancol etylic. Lượng ancol etylic thu được là bao nhiêu nếu ancol bị hao hụt mất 10% trong quá trình sản xuất?

A. 2 kg     B. 0,92 kg

C. 1,8 kg     D. 0,46 kg

Câu 20: Thuỷ phân este Z trong môi trường axit thu được hai chất hữu cơ X và Y (MX < MY). Bằng một phản ứng có thể chuyển hoá X thành Y. Chất Z không thể là

A. metyl propionat.

B. metyl axetat.

C. etyl axetat.

D. vinyl axetat.

Câu 21: Chỉ dùng duy nhất một thuốc thử nào dưới đây có thể phân biệt được 4 lọ mất nhãn chứa các chất sau: dung dịch glucozơ ; ancol etylic ; glixerol và anđehit axetic.

A. Cu(OH)2     B. Na

C. NaOH     D. Ag2O/NH3

Câu 22: Xà phòng hoá một hợp chất có công thức phân tử C10H14O6 trong dung dịch NaOH (dư), thu được glixerol và hỗn hợp gồm ba muối (không có đồng phân hình học). Công thức của ba muối đó là

A. CH2=CH-COONa, CH3-CH2-COONa và HCOONa.

B. HCOONa, CH≡C-COONa và CH3-CH2-COONa.

C. CH2=CH-COONa, HCOONa và CH≡C-COONa.

D. CH3-COONa, HCOONa và CH3-CH=CH-COONa.

Câu 23: Trong quá trình chuyển hoá tinh bột trong cơ thể, chất nào sau đây không phải là sản phẩm của quá trình đó?

A. Đextrin     B. Saccarozơ

C. Glicogen.     D. Mantozơ.

Câu 24: Chất hữu cơ X có công thức phân tử C4H6O4 tác dụng với dung dịch NaOH (đun nóng) theo phương trình phản ứng: C4H6O4 + 2NaOH → 2Z + Y.

Để oxi hoá hết a mol Y thì cần vừa đủ 2a mol CuO (đun nóng), sau phản ứng tạo thành a mol chất T (biết Y, Z, T là các hợp chất hữu cơ). Khối lượng phân tử của T là

A. 44 đvC.     B. 58 đvC.

C. 82 đvC.     D. 118 đvC.

Câu 25: Cho các dung dịch chứa các chất tan : glucozơ, fructozơ, saccarozơ, mantozơ, axit fomic, glixerol, vinyl axetat, anđehit fomic. Những dung dịch vừa hoà tan Cu(OH)2 ở nhiệt độ thường, vừa làm mất màu nước brom là?

A. glucozơ, mantozơ, axit fomic, vinyl axetat

B. glucozơ, mantozơ, axit fomic

C. glucozơ, mantozơ, fructozơ, saccarozơ, axit fomic

D. fructozơ, vinyl axetat, anđehit fomic, glixerol, glucozơ, saccarozơ

Câu 26: Một hỗn hợp X gồm hai chất hữu cơ đơn chức. Cho X phản ứng vừa đủ với 500 ml dung dịch KOH 1M. Sau phản ứng, thu được hỗn hợp Y gồm hai muối của hai axit cacboxylic và một ancol. Cho toàn bộ lượng ancol thu được ở trên tác dụng với Na (dư), sinh ra 3,36 lít H2 (ở đktc). Hỗn hợp X gồm

A. một axit và một este.

B. một este và một ancol.

C. hai este.

D. một axit và một ancol.

Câu 27: Xenlulozơ được cấu tạo bởi các gốc:

A. α-glucozơ     B. α-fructozơ

C. β-glucozơ     D. β-fructozơ

Câu 28: Cho m gam một este E vào một lượng vừa đủ KOH đun nóng thu được dung dịch X. Cô cạn X thu được 16,5 gam muối khan của một axit đơn chức và 6,9 gam một ancol đơn chức Y. Cho toàn bộ Y tác dụng với Na dư thu được 1,68 lít khí (ở đktc). Tên của E là

A. etyl propionat

B. etyl acrylat

C. metyl metacrylat

D. etyl axetat

Câu 29: Thực hiện phản ứng thủy phân a mol mantozơ trong môi trường axit( Hiệu suất thủy phân là h), sau đó trung hòa axit bằng kiềm rồi cho hỗn hợp sau phản ứng tác dụng với Ag2O dư trong NH3 thu được b mol Ag. Mối liên hệ giữa hiệu suất h với a và b là

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4)

Câu 30: Cho 2,07 gam chất hữu cơ X (có công thức phân tử C7H6O3) tác dụng với dung dịch NaOH vừa đủ, sau đó làm khô, phần bay hơi chỉ có nước, phần rắn khan còn lại chứa hỗn hợp hai muối. Nung hai muối này trong oxi dư, thu được 2,385 gam Na2CO3 và m gam hỗn hợp khí và hơi. Số đồng phân cấu tạo của X là

A. 3     B. 2

C. 5     D. 4

Đáp án & Thang điểm

Câu 1: Đáp án C

Fructozơ ngọt hơn đường mía còn glucozơ kém ngọt hơn.

Câu 2: Đáp án A

nCO2 = 0,3 mol; nH2O = 0,29 mol

Gọi công thức trung bình của triglixerit và axit tự do là (CnH2n + 1COO)3C3H5 và CnH2n + 1COOH với số mol lần lượt là x, y mol.

Ta có hpt:

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4)

⇒ x = 0,005 mol

ntriglixerit = nglixerol = 0,005 mol

H = 90% ⇒ mglixerol = 0,005.92.90% = 0,414 gam.

Câu 3: Đáp án A

Chất trong cấu tạo có các nhóm - OH cạnh nhau thì phản ứng với Cu(OH)2 tạo dung dịch màu xanh lam.

→ ancol etylic, OH-CH2-CH2-CH2-OH, OH-CH2 -CH=CH2 không phản ứng với Cu(OH)2.

Câu 4: Đáp án C

Etyl propionat là hợp chất không chứ liên kết hiđro là chất có nhiệt độ sôi thấp nhất ⇒ nhiệt độ sôi của T < (X, Y, Z)

Do có nhóm – C=O hút e trong phân tử nên X, Y có độ bền liên kết hiđro lớn hơn trong ancol Z → nhiệt độ sôi của Z < (X, Y)

Do MX > MY ⇒ nên nhiệt độ sôi của X > Y

Thứ tự nhiệt độ sôi của các chất là T < Z < Y < X.

Câu 5: Đáp án C

Khi rót H2SO4 đặc vào cốc đựng saccarozơ thì saccarozơ sẽ bị oxi hóa tạo ra C (tạo thành 1 khối đen), sau đó C tác dụng với H2SO4 đặc dư tạo ra khí CO2 kết hợp với SO2 đẩy khối đen lên trên miệng cốc.

Câu 6: Đáp án B

Các chất trong dãy khi thủy phân trong dung dịch NaOH loãng (dư), đun nóng sinh ra ancol là: metyl benzoat, metyl metacrylat, anlyl axetat, metyl axetat, etyl fomat, triolein, tristearin

Vậy có 7 chất.

Câu 7: Đáp án D

C12H22O11 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4) 12C + 11H2O

C + 2H2SO4 đặc → CO2↑ + 2SO2↑ + 2H2O

2 khí thoát ra là SO2 và CO2

Câu 8: Đáp án A

Từ ancol và các chất vô cơ cần thiết, ta có thể điều chế trực tiếp

(1) CH3COOH: C2H5OH + O2 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4) CH3COOH + H2O

(2) CH3CH2OH + CuO Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4) CH3CHO + Cu + H2O

(3) 2C2H5OH Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4) CH2=CH-CH=CH2 + 2H2O + H2

CH3COOC2H5 điều chế trực tiếp từ C2H5OH và CH3COOH nên không thỏa mãn

Câu 9: Đáp án D

Chất hữu cơ Y là xenlulozơ trinitrat (sản phẩm của xenlulozơ và HNO3) chất dễ cháy nổ, ứng dụng làm thuốc súng không khói.

[C6H7O2(OH)3]n + 3nHNO3(đặc) Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4) [C6H7O2(ONO2)3]n + 3nH2O.

Câu 10: Đáp án C

(2) sai vì axit oleic là C17H33COOH, axit linoleic là C17H31COOH nên hai chất không là đồng phân của nhau.

(3) sai vì axit axetyl salixylic tác dụng được với dung dịch NaOH theo tỉ lệ 1 : 3 về số mol:

o-CH3COO-C6H4-COOH + 3KOH → CH3COOK + KO-C6H4-COOK + 2H2O

(1), (4) đúng.

Ghi chú: Axit salixylic và Axit axetyl salixylic gặp trong bài tập 5 (trang 7) – SGK Hóa học 12 – nâng cao.

Câu 11: Đáp án C

Người ta dùng khí SO2 để tẩy màu, còn CO2 để tái tạo lại saccarozơ từ dung dịch đường có lẫn hợp chất của canxi.

Câu 12: Đáp án C

Độ bất bão hòa k = 1.

Các hợp chất tác dụng được với NaOH nhưng không tác dụng được với Na → các đồng phân este.

* Có 4 đồng phân cấu tạo thỏa mãn là:

1. HCOOCH2CH2CH3

2. HCOOCH(CH3)2

3. CH3COOCH2CH3

4. CH3CH2COOCH3

Câu 13: Đáp án C

Ở động vật, tinh bột được dự trữ dưới dạng glicogen ở trong gan. Lượng glucozơ trong máu luôn giữ không đổi 0,1% .Lượng glucozơ dư được chuyển về gan nhờ enzim chuyển hóa thành glicogen. Khi nồng độ glucozơ trong máu giảm dưới 0,1% thì glicogen bị thủy phân thành luôn glucozơ.

Câu 14: Đáp án D

Đáp án A đúng vì ancol có liên kết hiđro nên có nhiệt độ sôi cao hơn este có cùng phân tử khối.

Đáp án B đúng. Trong công nghiệp có thể chuyển hóa chất béo lỏng thành chất béo rắn bằng phản ứng hiđro hóa.

Đáp án C đúng. CTC của este là CnH2n+2-2k-2xO2x nên este đơn chức và đa chức luôn là một số chẵn.

Đáp án D sai. Sản phẩm của phản ứng xà phòng hóa chất béo là xà phòng (muối natri hoặc kali của các axit béo) và glixerol.

Câu 15: Đáp án A

[C6H7O2(OH)3]n + 3nHNO3 đ Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4) [C6H7O2(ONO2)3]n + 3nH2O (H = 90%)

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4)

Câu 16: Đáp án C

(C17H33COO)3C3H5 + 3H2 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4) (C17H35COO)3C3H5 (X)

(C17H35COO)3C3H5 + 3NaOH Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4) 3C17H35COONa (Y) + C3H5(OH)3

C17H35COONa + HCl → C17H35COOH (Z) + NaCl

Vậy Z là C17H35COOH: axit stearic.

Câu 17: Đáp án D

Tinh bột, xenlulozơ là polisaccarit; saccarozơ, mantozơ là đisaccarit nên đều tham gia phản ứng thủy phân

Câu 18: Đáp án A

Giả sử este có dạng CnH2nO2

Ta có

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4)

Ta có:

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4)

⇒ C2H4O2 ⇒ HCOOCH3 ⇒ metyl fomat

Câu 19: Đáp án B

C6H12O6 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4) 2C2H5OH + 2CO2.

Khối lượng glucozơ nguyên chất có trong 2,5 kg là mglucozơ = 2,5.80% = 2 kg

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4)

Lượng ancol hao hụt mất 10% → Hiệu suất phản ứng là 90%.

Với hiệu suất 90% thì

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4)

⇒ mancol etylic = 20. 46 = 920g = 0,92 kg.

Câu 20: Đáp án A

Xét CH3CH2COOCH3

CH3CH2COOCH3 + H2O ⇆ CH3CH2COOH + CH3OH

Tuy nhiên từ CH3OH (X) không thể điều chế CH3CH2COOH (Y) bằng một phản ứng.

• Xét CH3COOCH3

CH3COOCH3 + H2O ⇆ CH3COOH + CH3OH

CH3OH (X) + CO Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4) CH3COOH (Y)

Vậy Z có thể là CH3COOCH3.

• Xét CH3COOCH2CH3

CH3COOCH2CH3 + H2O ⇆ CH3COOH + CH3CH2OH

CH3CH2OH (X) + O2 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4) CH3COOH (Y) + H2O

Vậy Z có thể là CH3COOCH2CH3

• Xét CH3COOCH=CH2

CH3COOCH=CH2 + H2O ⇆ CH3COOH + CH3CHO

2CH3CHO (X) + O2 Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4) 2CH3COOH (Y)

Vậy Z có thể là CH3COOCH=CH2

Câu 21: Đáp án A

Khi cho các dung dịch glucozơ; rượu etylic; glixerin và anđehit axetic vào Cu(OH)2 thì:

+ Dung dịch glucozơ ở nhiệt độ thường tạo dung dịch phức màu xanh lam, đun nóng tạo kết tủa đỏ gạch Cu2O.

+ Dung dịch glixerin ở nhiệt độ thường và nhiệt độ cao tạo dung dịch phức màu xanh lam

+ Dung dịch anđehit ở nhiệt độ thường không hiện tượng, nhiệt độ cao tạo kết tủa đỏ gạch.

+ Dung dịch etanol không hiện tượng ở nhiệt độ thường và nhiệt độ cao.

Câu 22: Đáp án A

C10H14O6 có độ bất bão hòa

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4)

Vì X là trieste nên trong mạch còn một nối đôi ⇒ loại B, C.

Vì ba muối không có đồng phân hình học ⇒ loại D.

Câu 23: Đáp án B

Quá trình thủy phân tinh bột trong cơ thể :

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4)

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4)

Câu 24: Đáp án B

C4H6O4 có độ bất bão hòa

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4)

Vậy X là đieste no, mạch hở.

Oxi hóa a mol Y cần vừa đủ 2a mol CuO → a mol T. Vậy Y là ancol hai chức.

Vậy X là HCOOCH2CH2OCOH

HCOOCH2CH2OCOH + 2NaOH → 2HCOONa (X) + CH2OH-CH2OH (Y)

CH2OH-CH2OH (Y) + 2CuO -to OHC-CHO (T) + 2Cu + 2H2O

OHC-CHO (T) có M = 58

Câu 25: Đáp án B

Các chất vừa hòa tan được Cu(OH)2 ở nhiệt độ thường và làm mất màu dung dịch brom là: glucozơ; mantozơ; axit fomic.

Câu 26: Đáp án A

Hỗn hợp X gồm hai chất hữu cơ đơn chức.

X + 0,5 mol KOH ⇒ muối của hai axit cacboxylic và một ancol

Ancol + Na dư ⇒ 0,15 mol H2.

nKOH = 0,5 mol

nancol = 2.nH2 = 2.0,15 = 0,3 mol < nKOH

Chỉ có 1 chất phản ứng sinh ra rượu.

Mà thu được 2 muối ⇒ Có một chất là este và 1 chất là axit

Câu 27: Đáp án C

Xenlulozơ được cấu tạo bởi các gốc β-glucozơ bằng liên kết β-1,4- glicozit..

Câu 28: Đáp án B

Giả sử E là RCOOR'

Cô cạn X thu được 16,5 gam muối RCOOK và 6,9 gam R'OH

2R'OH (0,15) + 2Na → 2R'ONa + H2 (0,075 mol)

⇒ MR'OH = 6,9 : 0,15 = 46 ⇒ MR' = 29 ⇒ R' là C2H5-.

nRCOOK = nR'OH = 0,15 mol ⇒ MRCOOK = 16,5 : 0,15 = 110 ⇒ MR = 27 ⇒ R là CH2=CH-

X + KOH → CH2=CHCOOK + CH3CH2OH

Vậy X là CH2=CHCOOCH2CH3: etyl acrylat

Câu 29: Đáp án B

Đề kiểm tra Giữa kì 1 Hóa học 12 có đáp án (Đề 4)

Câu 30: Đáp án A

Ta có nNa2CO3 = 0,0225 mol → nNaOH = 0,045 mol, nX = 0,015 mol

Thấy nNaOH = 3 nX → X có cấu tạo HCOOC6H4OH (o, m, p)

HCOOC6H4OH + 3NaOH → HCOONa + C6H4(ONa)2 + 2H2O

Xem thêm các đề kiểm tra, đề thi Hóa học lớp 12 chọn lọc, có đáp án hay khác:

Giới thiệu kênh Youtube VietJack

Ngân hàng trắc nghiệm miễn phí ôn thi THPT Quốc Gia tại khoahoc.vietjack.com

CHỈ CÒN 250K 1 KHÓA HỌC BẤT KÌ, VIETJACK HỖ TRỢ DỊCH COVID

Tổng hợp các video dạy học từ các giáo viên giỏi nhất - CHỈ TỪ 399K tại khoahoc.vietjack.com

Tổng đài hỗ trợ đăng ký khóa học: 084 283 45 85


Các loạt bài lớp 12 khác
2004 - Toán Lý Hóa